C14H13N3O3S3 — CID 3370146
N-(benzenesulfonamidocarbamothioyl)-3-thiophen-2-ylprop-2-enamide (PubChem CID 3370146) has the molecular formula C14H13N3O3S3 and a molecular weight of 367.48 g/mol. Its IUPAC name is N-(benzenesulfonamidocarbamothioyl)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-(benzenesulfonamidocarbamothioyl)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 3370146 |
| Molecular Formula | C14H13N3O3S3 |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | N-(benzenesulfonamidocarbamothioyl)-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(C=Cc1cccs1)NC(=S)NNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H13N3O3S3/c18-13(9-8-11-5-4-10-22-11)15-14(21)16-17-23(19,20)12-6-2-1-3-7-12/h1-10,17H,(H2,15,16,18,21) |
| InChIKey | LCRMSPNHRCEBRH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|