C18H21N3O3S3 — CID 3257983
N-[[4-(tert-butylsulfamoyl)phenyl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 3257983) has the molecular formula C18H21N3O3S3 and a molecular weight of 423.59 g/mol. Its IUPAC name is N-[[4-(tert-butylsulfamoyl)phenyl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-[[4-(tert-butylsulfamoyl)phenyl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 3257983 |
| Molecular Formula | C18H21N3O3S3 |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | N-[[4-(tert-butylsulfamoyl)phenyl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(NC(=S)NC(=O)C=Cc2cccs2)cc1 |
| InChI | InChI=1S/C18H21N3O3S3/c1-18(2,3)21-27(23,24)15-9-6-13(7-10-15)19-17(25)20-16(22)11-8-14-5-4-12-26-14/h4-12,21H,1-3H3,(H2,19,20,22,25) |
| InChIKey | NQOSHEFANLICMZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|