C21H20N4O5S3 — CID 161376252
(E)-N-[[4-[(2,6-dimethoxypyrimidin-4-yl)methylsulfonyl]phenyl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 161376252) has the molecular formula C21H20N4O5S3 and a molecular weight of 504.62 g/mol. Its IUPAC name is (E)-N-[[4-[(2,6-dimethoxypyrimidin-4-yl)methylsulfonyl]phenyl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[[4-[(2,6-dimethoxypyrimidin-4-yl)methylsulfonyl]phenyl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 161376252 |
| Molecular Formula | C21H20N4O5S3 |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.06 |
| IUPAC Name | (E)-N-[[4-[(2,6-dimethoxypyrimidin-4-yl)methylsulfonyl]phenyl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | COc1cc(CS(=O)(=O)c2ccc(NC(=S)NC(=O)/C=C/c3cccs3)cc2)nc(OC)n1 |
| InChI | InChI=1S/C21H20N4O5S3/c1-29-19-12-15(22-20(25-19)30-2)13-33(27,28)17-8-5-14(6-9-17)23-21(31)24-18(26)10-7-16-4-3-11-32-16/h3-12H,13H2,1-2H3,(H2,23,24,26,31)/b10-7+ |
| InChIKey | VRCSKQHZWNJWBE-JXMROGBWSA-N |
| XLogP | 3.06 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|