C19H17N5O4S3 — CID 3097477
N-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 3097477) has the molecular formula C19H17N5O4S3 and a molecular weight of 475.58 g/mol. Its IUPAC name is N-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 3097477 |
| Molecular Formula | C19H17N5O4S3 |
| Molecular Weight | 475.58 g/mol |
| Exact Mass | 475.04 |
| IUPAC Name | N-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | COc1nccnc1NS(=O)(=O)c1ccc(NC(=S)NC(=O)C=Cc2cccs2)cc1 |
| InChI | InChI=1S/C19H17N5O4S3/c1-28-18-17(20-10-11-21-18)24-31(26,27)15-7-4-13(5-8-15)22-19(29)23-16(25)9-6-14-3-2-12-30-14/h2-12H,1H3,(H,20,24)(H2,22,23,25,29) |
| InChIKey | BMAFBEBAOGNILU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.58 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|