C19H23N5O7S2 — CID 54783030
2-methoxyethyl 4-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]carbamothioylamino]-4-oxobutanoate (PubChem CID 54783030) has the molecular formula C19H23N5O7S2 and a molecular weight of 497.56 g/mol. Its IUPAC name is 2-methoxyethyl 4-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]carbamothioylamino]-4-oxobutanoate.
| Compound Name | 2-methoxyethyl 4-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 54783030 |
| Molecular Formula | C19H23N5O7S2 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | 2-methoxyethyl 4-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]carbamothioylamino]-4-oxobutanoate |
| SMILES | COCCOC(=O)CCC(=O)NC(=S)Nc1ccc(S(=O)(=O)Nc2nccnc2OC)cc1 |
| InChI | InChI=1S/C19H23N5O7S2/c1-29-11-12-31-16(26)8-7-15(25)23-19(32)22-13-3-5-14(6-4-13)33(27,28)24-17-18(30-2)21-10-9-20-17/h3-6,9-10H,7-8,11-12H2,1-2H3,(H,20,24)(H2,22,23,25,32) |
| InChIKey | ZTPLFCAIZXXMSK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 157.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|