C17H25N3O6S2 — CID 17338866
2-methoxyethyl 4-oxo-4-[[4-(propan-2-ylsulfamoyl)phenyl]carbamothioylamino]butanoate (PubChem CID 17338866) has the molecular formula C17H25N3O6S2 and a molecular weight of 431.54 g/mol. Its IUPAC name is 2-methoxyethyl 4-oxo-4-[[4-(propan-2-ylsulfamoyl)phenyl]carbamothioylamino]butanoate.
| Compound Name | 2-methoxyethyl 4-oxo-4-[[4-(propan-2-ylsulfamoyl)phenyl]carbamothioylamino]butanoate |
|---|---|
| PubChem CID | 17338866 |
| Molecular Formula | C17H25N3O6S2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 2-methoxyethyl 4-oxo-4-[[4-(propan-2-ylsulfamoyl)phenyl]carbamothioylamino]butanoate |
| SMILES | COCCOC(=O)CCC(=O)NC(=S)Nc1ccc(S(=O)(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C17H25N3O6S2/c1-12(2)20-28(23,24)14-6-4-13(5-7-14)18-17(27)19-15(21)8-9-16(22)26-11-10-25-3/h4-7,12,20H,8-11H2,1-3H3,(H2,18,19,21,27) |
| InChIKey | ANCLRTHUFQCGHT-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|