C23H26ClN3O6S — CID 43888113
2-methoxyethyl 4-[[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]carbamothioylamino]-4-oxobutanoate (PubChem CID 43888113) has the molecular formula C23H26ClN3O6S and a molecular weight of 508.00 g/mol. Its IUPAC name is 2-methoxyethyl 4-[[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]carbamothioylamino]-4-oxobutanoate.
| Compound Name | 2-methoxyethyl 4-[[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 43888113 |
| Molecular Formula | C23H26ClN3O6S |
| Molecular Weight | 508.00 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | 2-methoxyethyl 4-[[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]carbamothioylamino]-4-oxobutanoate |
| SMILES | COCCOC(=O)CCC(=O)NC(=S)Nc1ccc(NC(=O)C(C)Oc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C23H26ClN3O6S/c1-15(33-19-6-4-3-5-18(19)24)22(30)25-16-7-9-17(10-8-16)26-23(34)27-20(28)11-12-21(29)32-14-13-31-2/h3-10,15H,11-14H2,1-2H3,(H,25,30)(H2,26,27,28,34) |
| InChIKey | GLMFCUKRANTKGM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.00 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|