C25H22ClN3O5S — CID 43888145
methyl 3-[[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]carbamothioylcarbamoyl]benzoate (PubChem CID 43888145) has the molecular formula C25H22ClN3O5S and a molecular weight of 511.99 g/mol. Its IUPAC name is methyl 3-[[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]carbamothioylcarbamoyl]benzoate.
| Compound Name | methyl 3-[[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]carbamothioylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 43888145 |
| Molecular Formula | C25H22ClN3O5S |
| Molecular Weight | 511.99 g/mol |
| Exact Mass | 511.10 |
| IUPAC Name | methyl 3-[[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]carbamothioylcarbamoyl]benzoate |
| SMILES | COC(=O)c1cccc(C(=O)NC(=S)Nc2ccc(NC(=O)C(C)Oc3ccccc3Cl)cc2)c1 |
| InChI | InChI=1S/C25H22ClN3O5S/c1-15(34-21-9-4-3-8-20(21)26)22(30)27-18-10-12-19(13-11-18)28-25(35)29-23(31)16-6-5-7-17(14-16)24(32)33-2/h3-15H,1-2H3,(H,27,30)(H2,28,29,31,35) |
| InChIKey | ZTMNPVMHJUUGOH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.99 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|