C25H23BrClN3O4S — CID 43888132
3-bromo-N-[[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]carbamothioyl]-4-ethoxybenzamide (PubChem CID 43888132) has the molecular formula C25H23BrClN3O4S and a molecular weight of 576.90 g/mol. Its IUPAC name is 3-bromo-N-[[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]carbamothioyl]-4-ethoxybenzamide.
| Compound Name | 3-bromo-N-[[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]carbamothioyl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 43888132 |
| Molecular Formula | C25H23BrClN3O4S |
| Molecular Weight | 576.90 g/mol |
| Exact Mass | 575.03 |
| IUPAC Name | 3-bromo-N-[[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]carbamothioyl]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NC(=S)Nc2ccc(NC(=O)C(C)Oc3ccccc3Cl)cc2)cc1Br |
| InChI | InChI=1S/C25H23BrClN3O4S/c1-3-33-21-13-8-16(14-19(21)26)24(32)30-25(35)29-18-11-9-17(10-12-18)28-23(31)15(2)34-22-7-5-4-6-20(22)27/h4-15H,3H2,1-2H3,(H,28,31)(H2,29,30,32,35) |
| InChIKey | KHKFUAIUSCOWPZ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.90 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|