C27H26BrClN2O5 — CID 43887864
3-bromo-N-[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]-4-(oxolan-2-ylmethoxy)benzamide (PubChem CID 43887864) has the molecular formula C27H26BrClN2O5 and a molecular weight of 573.87 g/mol. Its IUPAC name is 3-bromo-N-[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]-4-(oxolan-2-ylmethoxy)benzamide.
| Compound Name | 3-bromo-N-[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]-4-(oxolan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 43887864 |
| Molecular Formula | C27H26BrClN2O5 |
| Molecular Weight | 573.87 g/mol |
| Exact Mass | 572.07 |
| IUPAC Name | 3-bromo-N-[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]-4-(oxolan-2-ylmethoxy)benzamide |
| SMILES | CC(Oc1ccccc1Cl)C(=O)Nc1ccc(NC(=O)c2ccc(OCC3CCCO3)c(Br)c2)cc1 |
| InChI | InChI=1S/C27H26BrClN2O5/c1-17(36-25-7-3-2-6-23(25)29)26(32)30-19-9-11-20(12-10-19)31-27(33)18-8-13-24(22(28)15-18)35-16-21-5-4-14-34-21/h2-3,6-13,15,17,21H,4-5,14,16H2,1H3,(H,30,32)(H,31,33) |
| InChIKey | FADPBYHDWLBNGX-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.87 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |