C18H16BrClN2O5 — CID 17131666
3-bromo-N-(4-chloro-3-nitrophenyl)-4-(oxolan-2-ylmethoxy)benzamide (PubChem CID 17131666) has the molecular formula C18H16BrClN2O5 and a molecular weight of 455.69 g/mol. Its IUPAC name is 3-bromo-N-(4-chloro-3-nitrophenyl)-4-(oxolan-2-ylmethoxy)benzamide.
| Compound Name | 3-bromo-N-(4-chloro-3-nitrophenyl)-4-(oxolan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 17131666 |
| Molecular Formula | C18H16BrClN2O5 |
| Molecular Weight | 455.69 g/mol |
| Exact Mass | 453.99 |
| IUPAC Name | 3-bromo-N-(4-chloro-3-nitrophenyl)-4-(oxolan-2-ylmethoxy)benzamide |
| SMILES | O=C(Nc1ccc(Cl)c([N+](=O)[O-])c1)c1ccc(OCC2CCCO2)c(Br)c1 |
| InChI | InChI=1S/C18H16BrClN2O5/c19-14-8-11(3-6-17(14)27-10-13-2-1-7-26-13)18(23)21-12-4-5-15(20)16(9-12)22(24)25/h3-6,8-9,13H,1-2,7,10H2,(H,21,23) |
| InChIKey | LPZICCKVEAEZNO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.69 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|