C31H28ClN3O5S — CID 43888101
N-[[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]carbamothioyl]-4-(2-phenoxyethoxy)benzamide (PubChem CID 43888101) has the molecular formula C31H28ClN3O5S and a molecular weight of 590.10 g/mol. Its IUPAC name is N-[[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]carbamothioyl]-4-(2-phenoxyethoxy)benzamide.
| Compound Name | N-[[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]carbamothioyl]-4-(2-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 43888101 |
| Molecular Formula | C31H28ClN3O5S |
| Molecular Weight | 590.10 g/mol |
| Exact Mass | 589.14 |
| IUPAC Name | N-[[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]carbamothioyl]-4-(2-phenoxyethoxy)benzamide |
| SMILES | CC(Oc1ccccc1Cl)C(=O)Nc1ccc(NC(=S)NC(=O)c2ccc(OCCOc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C31H28ClN3O5S/c1-21(40-28-10-6-5-9-27(28)32)29(36)33-23-13-15-24(16-14-23)34-31(41)35-30(37)22-11-17-26(18-12-22)39-20-19-38-25-7-3-2-4-8-25/h2-18,21H,19-20H2,1H3,(H,33,36)(H2,34,35,37,41) |
| InChIKey | LIHAASHQUJFHND-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.10 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|