C28H23ClN2O3 — CID 43887670
N-[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]-4-phenylbenzamide (PubChem CID 43887670) has the molecular formula C28H23ClN2O3 and a molecular weight of 470.96 g/mol. Its IUPAC name is N-[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]-4-phenylbenzamide.
| Compound Name | N-[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 43887670 |
| Molecular Formula | C28H23ClN2O3 |
| Molecular Weight | 470.96 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | N-[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]-4-phenylbenzamide |
| SMILES | CC(Oc1ccccc1Cl)C(=O)Nc1ccc(NC(=O)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H23ClN2O3/c1-19(34-26-10-6-5-9-25(26)29)27(32)30-23-15-17-24(18-16-23)31-28(33)22-13-11-21(12-14-22)20-7-3-2-4-8-20/h2-19H,1H3,(H,30,32)(H,31,33) |
| InChIKey | DCQIPPRCQDCMHV-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.96 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |