C27H29ClN2O4 — CID 43887800
N-[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]-4-(3-methylbutoxy)benzamide (PubChem CID 43887800) has the molecular formula C27H29ClN2O4 and a molecular weight of 480.99 g/mol. Its IUPAC name is N-[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]-4-(3-methylbutoxy)benzamide.
| Compound Name | N-[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]-4-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 43887800 |
| Molecular Formula | C27H29ClN2O4 |
| Molecular Weight | 480.99 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | N-[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]-4-(3-methylbutoxy)benzamide |
| SMILES | CC(C)CCOc1ccc(C(=O)Nc2ccc(NC(=O)C(C)Oc3ccccc3Cl)cc2)cc1 |
| InChI | InChI=1S/C27H29ClN2O4/c1-18(2)16-17-33-23-14-8-20(9-15-23)27(32)30-22-12-10-21(11-13-22)29-26(31)19(3)34-25-7-5-4-6-24(25)28/h4-15,18-19H,16-17H2,1-3H3,(H,29,31)(H,30,32) |
| InChIKey | NGTPSNFKVNJMLD-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.99 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |