C17H16BrClN2O3S — CID 1338797
3-bromo-N-[(3-chloro-4-methoxyphenyl)carbamothioyl]-4-ethoxybenzamide (PubChem CID 1338797) has the molecular formula C17H16BrClN2O3S and a molecular weight of 443.75 g/mol. Its IUPAC name is 3-bromo-N-[(3-chloro-4-methoxyphenyl)carbamothioyl]-4-ethoxybenzamide.
| Compound Name | 3-bromo-N-[(3-chloro-4-methoxyphenyl)carbamothioyl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 1338797 |
| Molecular Formula | C17H16BrClN2O3S |
| Molecular Weight | 443.75 g/mol |
| Exact Mass | 441.98 |
| IUPAC Name | 3-bromo-N-[(3-chloro-4-methoxyphenyl)carbamothioyl]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NC(=S)Nc2ccc(OC)c(Cl)c2)cc1Br |
| InChI | InChI=1S/C17H16BrClN2O3S/c1-3-24-14-6-4-10(8-12(14)18)16(22)21-17(25)20-11-5-7-15(23-2)13(19)9-11/h4-9H,3H2,1-2H3,(H2,20,21,22,25) |
| InChIKey | LQPITKVCBCZUMW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.75 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|