C22H25BrClN3O2S — CID 17116440
3-bromo-N-[[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]carbamothioyl]-4-ethoxybenzamide (PubChem CID 17116440) has the molecular formula C22H25BrClN3O2S and a molecular weight of 510.89 g/mol. Its IUPAC name is 3-bromo-N-[[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]carbamothioyl]-4-ethoxybenzamide.
| Compound Name | 3-bromo-N-[[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]carbamothioyl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 17116440 |
| Molecular Formula | C22H25BrClN3O2S |
| Molecular Weight | 510.89 g/mol |
| Exact Mass | 509.05 |
| IUPAC Name | 3-bromo-N-[[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]carbamothioyl]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NC(=S)Nc2ccc(N3CCC(C)CC3)c(Cl)c2)cc1Br |
| InChI | InChI=1S/C22H25BrClN3O2S/c1-3-29-20-7-4-15(12-17(20)23)21(28)26-22(30)25-16-5-6-19(18(24)13-16)27-10-8-14(2)9-11-27/h4-7,12-14H,3,8-11H2,1-2H3,(H2,25,26,28,30) |
| InChIKey | DGDDAYNKUMEUNN-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.89 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|