C20H21BrClN3OS — CID 17110233
4-bromo-N-[[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]carbamothioyl]benzamide (PubChem CID 17110233) has the molecular formula C20H21BrClN3OS and a molecular weight of 466.83 g/mol. Its IUPAC name is 4-bromo-N-[[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 4-bromo-N-[[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17110233 |
| Molecular Formula | C20H21BrClN3OS |
| Molecular Weight | 466.83 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | 4-bromo-N-[[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]carbamothioyl]benzamide |
| SMILES | CC1CCN(c2ccc(NC(=S)NC(=O)c3ccc(Br)cc3)cc2Cl)CC1 |
| InChI | InChI=1S/C20H21BrClN3OS/c1-13-8-10-25(11-9-13)18-7-6-16(12-17(18)22)23-20(27)24-19(26)14-2-4-15(21)5-3-14/h2-7,12-13H,8-11H2,1H3,(H2,23,24,26,27) |
| InChIKey | XTFNHVUKAZWNTQ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.83 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|