C20H22ClN3O2S — CID 2206227
N-[(3-chloro-4-morpholin-4-ylphenyl)carbamothioyl]-3,5-dimethylbenzamide (PubChem CID 2206227) has the molecular formula C20H22ClN3O2S and a molecular weight of 403.94 g/mol. Its IUPAC name is N-[(3-chloro-4-morpholin-4-ylphenyl)carbamothioyl]-3,5-dimethylbenzamide.
| Compound Name | N-[(3-chloro-4-morpholin-4-ylphenyl)carbamothioyl]-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 2206227 |
| Molecular Formula | C20H22ClN3O2S |
| Molecular Weight | 403.94 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | N-[(3-chloro-4-morpholin-4-ylphenyl)carbamothioyl]-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C)cc(C(=O)NC(=S)Nc2ccc(N3CCOCC3)c(Cl)c2)c1 |
| InChI | InChI=1S/C20H22ClN3O2S/c1-13-9-14(2)11-15(10-13)19(25)23-20(27)22-16-3-4-18(17(21)12-16)24-5-7-26-8-6-24/h3-4,9-12H,5-8H2,1-2H3,(H2,22,23,25,27) |
| InChIKey | RPHSXOHXLOSSDI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.94 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|