C20H21Cl2N3O3S — CID 1016468
2-(4-chloro-2-methylphenoxy)-N-[(3-chloro-4-morpholin-4-ylphenyl)carbamothioyl]acetamide (PubChem CID 1016468) has the molecular formula C20H21Cl2N3O3S and a molecular weight of 454.38 g/mol. Its IUPAC name is 2-(4-chloro-2-methylphenoxy)-N-[(3-chloro-4-morpholin-4-ylphenyl)carbamothioyl]acetamide.
| Compound Name | 2-(4-chloro-2-methylphenoxy)-N-[(3-chloro-4-morpholin-4-ylphenyl)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 1016468 |
| Molecular Formula | C20H21Cl2N3O3S |
| Molecular Weight | 454.38 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | 2-(4-chloro-2-methylphenoxy)-N-[(3-chloro-4-morpholin-4-ylphenyl)carbamothioyl]acetamide |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)NC(=S)Nc1ccc(N2CCOCC2)c(Cl)c1 |
| InChI | InChI=1S/C20H21Cl2N3O3S/c1-13-10-14(21)2-5-18(13)28-12-19(26)24-20(29)23-15-3-4-17(16(22)11-15)25-6-8-27-9-7-25/h2-5,10-11H,6-9,12H2,1H3,(H2,23,24,26,29) |
| InChIKey | ACEKHUPCYYSEHJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|