C23H27Cl2N3O3 — CID 1397453
2-(4-chloro-2-methylphenoxy)-N-[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]acetamide (PubChem CID 1397453) has the molecular formula C23H27Cl2N3O3 and a molecular weight of 464.39 g/mol. Its IUPAC name is 2-(4-chloro-2-methylphenoxy)-N-[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]acetamide.
| Compound Name | 2-(4-chloro-2-methylphenoxy)-N-[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 1397453 |
| Molecular Formula | C23H27Cl2N3O3 |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 2-(4-chloro-2-methylphenoxy)-N-[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]acetamide |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)Nc1ccc(N2CCN(C(=O)C(C)C)CC2)c(Cl)c1 |
| InChI | InChI=1S/C23H27Cl2N3O3/c1-15(2)23(30)28-10-8-27(9-11-28)20-6-5-18(13-19(20)25)26-22(29)14-31-21-7-4-17(24)12-16(21)3/h4-7,12-13,15H,8-11,14H2,1-3H3,(H,26,29) |
| InChIKey | YOQTUSWMVSEXKK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|