C23H26Cl2N4O2S — CID 4010139
N-[[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]carbamothioyl]-2-(4-chlorophenyl)acetamide (PubChem CID 4010139) has the molecular formula C23H26Cl2N4O2S and a molecular weight of 493.46 g/mol. Its IUPAC name is N-[[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]carbamothioyl]-2-(4-chlorophenyl)acetamide.
| Compound Name | N-[[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]carbamothioyl]-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 4010139 |
| Molecular Formula | C23H26Cl2N4O2S |
| Molecular Weight | 493.46 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | N-[[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]carbamothioyl]-2-(4-chlorophenyl)acetamide |
| SMILES | CC(C)C(=O)N1CCN(c2ccc(NC(=S)NC(=O)Cc3ccc(Cl)cc3)cc2Cl)CC1 |
| InChI | InChI=1S/C23H26Cl2N4O2S/c1-15(2)22(31)29-11-9-28(10-12-29)20-8-7-18(14-19(20)25)26-23(32)27-21(30)13-16-3-5-17(24)6-4-16/h3-8,14-15H,9-13H2,1-2H3,(H2,26,27,30,32) |
| InChIKey | CSOKWERVTKASBF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|