C23H25Cl3N4O3S — CID 3333717
3,5-dichloro-N-[[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]carbamothioyl]-2-methoxybenzamide (PubChem CID 3333717) has the molecular formula C23H25Cl3N4O3S and a molecular weight of 543.90 g/mol. Its IUPAC name is 3,5-dichloro-N-[[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]carbamothioyl]-2-methoxybenzamide.
| Compound Name | 3,5-dichloro-N-[[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 3333717 |
| Molecular Formula | C23H25Cl3N4O3S |
| Molecular Weight | 543.90 g/mol |
| Exact Mass | 542.07 |
| IUPAC Name | 3,5-dichloro-N-[[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]carbamothioyl]-2-methoxybenzamide |
| SMILES | COc1c(Cl)cc(Cl)cc1C(=O)NC(=S)Nc1ccc(N2CCN(C(=O)C(C)C)CC2)c(Cl)c1 |
| InChI | InChI=1S/C23H25Cl3N4O3S/c1-13(2)22(32)30-8-6-29(7-9-30)19-5-4-15(12-17(19)25)27-23(34)28-21(31)16-10-14(24)11-18(26)20(16)33-3/h4-5,10-13H,6-9H2,1-3H3,(H2,27,28,31,34) |
| InChIKey | WGSBMTQFPDQONW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.90 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|