C19H20Cl3N3O2 — CID 3966060
3,5-dichloro-N-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]-2-methoxybenzamide (PubChem CID 3966060) has the molecular formula C19H20Cl3N3O2 and a molecular weight of 428.75 g/mol. Its IUPAC name is 3,5-dichloro-N-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]-2-methoxybenzamide.
| Compound Name | 3,5-dichloro-N-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 3966060 |
| Molecular Formula | C19H20Cl3N3O2 |
| Molecular Weight | 428.75 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 3,5-dichloro-N-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]-2-methoxybenzamide |
| SMILES | COc1c(Cl)cc(Cl)cc1C(=O)Nc1ccc(N2CCN(C)CC2)c(Cl)c1 |
| InChI | InChI=1S/C19H20Cl3N3O2/c1-24-5-7-25(8-6-24)17-4-3-13(11-15(17)21)23-19(26)14-9-12(20)10-16(22)18(14)27-2/h3-4,9-11H,5-8H2,1-2H3,(H,23,26) |
| InChIKey | VAZBSPGTLKUCMW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.75 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|