C22H24Cl3N3O3 — CID 5116507
3,5-dichloro-N-[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]-4-methoxybenzamide (PubChem CID 5116507) has the molecular formula C22H24Cl3N3O3 and a molecular weight of 484.81 g/mol. Its IUPAC name is 3,5-dichloro-N-[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]-4-methoxybenzamide.
| Compound Name | 3,5-dichloro-N-[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 5116507 |
| Molecular Formula | C22H24Cl3N3O3 |
| Molecular Weight | 484.81 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | 3,5-dichloro-N-[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]-4-methoxybenzamide |
| SMILES | COc1c(Cl)cc(C(=O)Nc2ccc(N3CCN(C(=O)C(C)C)CC3)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C22H24Cl3N3O3/c1-13(2)22(30)28-8-6-27(7-9-28)19-5-4-15(12-16(19)23)26-21(29)14-10-17(24)20(31-3)18(25)11-14/h4-5,10-13H,6-9H2,1-3H3,(H,26,29) |
| InChIKey | VKRLXZXLYAXVOL-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.81 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|