C25H24Cl3N3O3 — CID 17319211
N-[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]-5-(2,3-dichlorophenyl)furan-2-carboxamide (PubChem CID 17319211) has the molecular formula C25H24Cl3N3O3 and a molecular weight of 520.84 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]-5-(2,3-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]-5-(2,3-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17319211 |
| Molecular Formula | C25H24Cl3N3O3 |
| Molecular Weight | 520.84 g/mol |
| Exact Mass | 519.09 |
| IUPAC Name | N-[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]-5-(2,3-dichlorophenyl)furan-2-carboxamide |
| SMILES | CC(C)C(=O)N1CCN(c2ccc(NC(=O)c3ccc(-c4cccc(Cl)c4Cl)o3)cc2Cl)CC1 |
| InChI | InChI=1S/C25H24Cl3N3O3/c1-15(2)25(33)31-12-10-30(11-13-31)20-7-6-16(14-19(20)27)29-24(32)22-9-8-21(34-22)17-4-3-5-18(26)23(17)28/h3-9,14-15H,10-13H2,1-2H3,(H,29,32) |
| InChIKey | GFCAWVHRBVKURF-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.84 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|