C27H26Cl3N3O3 — CID 43913588
(E)-N-[5-chloro-2-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 43913588) has the molecular formula C27H26Cl3N3O3 and a molecular weight of 546.88 g/mol. Its IUPAC name is (E)-N-[5-chloro-2-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[5-chloro-2-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 43913588 |
| Molecular Formula | C27H26Cl3N3O3 |
| Molecular Weight | 546.88 g/mol |
| Exact Mass | 545.10 |
| IUPAC Name | (E)-N-[5-chloro-2-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | CC(C)C(=O)N1CCN(c2ccc(Cl)cc2NC(=O)/C=C/c2ccc(-c3cccc(Cl)c3Cl)o2)CC1 |
| InChI | InChI=1S/C27H26Cl3N3O3/c1-17(2)27(35)33-14-12-32(13-15-33)23-9-6-18(28)16-22(23)31-25(34)11-8-19-7-10-24(36-19)20-4-3-5-21(29)26(20)30/h3-11,16-17H,12-15H2,1-2H3,(H,31,34)/b11-8+ |
| InChIKey | NMDDGWNAQUKRDD-DHZHZOJOSA-N |
| XLogP | 6.86 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.88 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|