C24H19Cl2F3N2O2 — CID 17117731
(E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 17117731) has the molecular formula C24H19Cl2F3N2O2 and a molecular weight of 495.33 g/mol. Its IUPAC name is (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 17117731 |
| Molecular Formula | C24H19Cl2F3N2O2 |
| Molecular Weight | 495.33 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccc(Cl)cc2Cl)o1)Nc1cc(C(F)(F)F)ccc1N1CCCC1 |
| InChI | InChI=1S/C24H19Cl2F3N2O2/c25-16-4-7-18(19(26)14-16)22-9-5-17(33-22)6-10-23(32)30-20-13-15(24(27,28)29)3-8-21(20)31-11-1-2-12-31/h3-10,13-14H,1-2,11-12H2,(H,30,32)/b10-6+ |
| InChIKey | UNMULARPIFZNRF-UXBLZVDNSA-N |
| XLogP | 7.52 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.33 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|