C24H12Cl3F3O3 — CID 3444005
3-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-1-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-en-1-one (PubChem CID 3444005) has the molecular formula C24H12Cl3F3O3 and a molecular weight of 511.71 g/mol. Its IUPAC name is 3-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-1-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-en-1-one.
| Compound Name | 3-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-1-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 3444005 |
| Molecular Formula | C24H12Cl3F3O3 |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 509.98 |
| IUPAC Name | 3-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-1-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(-c2cc(C(F)(F)F)ccc2Cl)o1)c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C24H12Cl3F3O3/c25-14-2-5-16(19(27)12-14)21-9-10-23(33-21)20(31)7-3-15-4-8-22(32-15)17-11-13(24(28,29)30)1-6-18(17)26/h1-12H |
| InChIKey | RUVXEZRLYNKQQP-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|