C12H6ClF3O2 — CID 623670
5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-carbaldehyde (PubChem CID 623670) has the molecular formula C12H6ClF3O2 and a molecular weight of 274.62 g/mol. Its IUPAC name is 5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-carbaldehyde.
| Compound Name | 5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 623670 |
| Molecular Formula | C12H6ClF3O2 |
| Molecular Weight | 274.62 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2cc(C(F)(F)F)ccc2Cl)o1 |
| InChI | InChI=1S/C12H6ClF3O2/c13-10-3-1-7(12(14,15)16)5-9(10)11-4-2-8(6-17)18-11/h1-6H |
| InChIKey | BDUFOVWZBTVLPY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.62 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|