C12H7ClF3NO2 — CID 28689333
(NZ)-N-[[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylidene]hydroxylamine (PubChem CID 28689333) has the molecular formula C12H7ClF3NO2 and a molecular weight of 289.64 g/mol. Its IUPAC name is (NZ)-N-[[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 28689333 |
| Molecular Formula | C12H7ClF3NO2 |
| Molecular Weight | 289.64 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | (NZ)-N-[[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylidene]hydroxylamine |
| SMILES | O/N=C\c1ccc(-c2cc(C(F)(F)F)ccc2Cl)o1 |
| InChI | InChI=1S/C12H7ClF3NO2/c13-10-3-1-7(12(14,15)16)5-9(10)11-4-2-8(19-11)6-17-18/h1-6,18H/b17-6- |
| InChIKey | UFZQOHRTWAIKJJ-FMQZQXMHSA-N |
| XLogP | 4.43 |
| TPSA | 45.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.64 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|