C18H9ClF3NOS — CID 6006016
(E)-3-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-2-thiophen-2-ylprop-2-enenitrile (PubChem CID 6006016) has the molecular formula C18H9ClF3NOS and a molecular weight of 379.79 g/mol. Its IUPAC name is (E)-3-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-2-thiophen-2-ylprop-2-enenitrile.
| Compound Name | (E)-3-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-2-thiophen-2-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 6006016 |
| Molecular Formula | C18H9ClF3NOS |
| Molecular Weight | 379.79 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | (E)-3-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-2-thiophen-2-ylprop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(-c2cc(C(F)(F)F)ccc2Cl)o1)c1cccs1 |
| InChI | InChI=1S/C18H9ClF3NOS/c19-15-5-3-12(18(20,21)22)9-14(15)16-6-4-13(24-16)8-11(10-23)17-2-1-7-25-17/h1-9H/b11-8+ |
| InChIKey | VFHYGYMWOSGKCO-DHZHZOJOSA-N |
| XLogP | 6.74 |
| TPSA | 36.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.79 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|