C19H10Cl3NO — CID 5168069
2-(4-chlorophenyl)-3-[5-(2,5-dichlorophenyl)furan-2-yl]prop-2-enenitrile (PubChem CID 5168069) has the molecular formula C19H10Cl3NO and a molecular weight of 374.65 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-[5-(2,5-dichlorophenyl)furan-2-yl]prop-2-enenitrile.
| Compound Name | 2-(4-chlorophenyl)-3-[5-(2,5-dichlorophenyl)furan-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 5168069 |
| Molecular Formula | C19H10Cl3NO |
| Molecular Weight | 374.65 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | 2-(4-chlorophenyl)-3-[5-(2,5-dichlorophenyl)furan-2-yl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(-c2cc(Cl)ccc2Cl)o1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H10Cl3NO/c20-14-3-1-12(2-4-14)13(11-23)9-16-6-8-19(24-16)17-10-15(21)5-7-18(17)22/h1-10H |
| InChIKey | KHLWLYWPTAKNGZ-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 36.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.65 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|