C21H10Cl3N3O2 — CID 135782554
(E)-2-(6-chloro-4-oxo-3H-quinazolin-2-yl)-3-[5-(2,5-dichlorophenyl)furan-2-yl]prop-2-enenitrile (PubChem CID 135782554) has the molecular formula C21H10Cl3N3O2 and a molecular weight of 442.69 g/mol. Its IUPAC name is (E)-2-(6-chloro-4-oxo-3H-quinazolin-2-yl)-3-[5-(2,5-dichlorophenyl)furan-2-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(6-chloro-4-oxo-3H-quinazolin-2-yl)-3-[5-(2,5-dichlorophenyl)furan-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 135782554 |
| Molecular Formula | C21H10Cl3N3O2 |
| Molecular Weight | 442.69 g/mol |
| Exact Mass | 440.98 |
| IUPAC Name | (E)-2-(6-chloro-4-oxo-3H-quinazolin-2-yl)-3-[5-(2,5-dichlorophenyl)furan-2-yl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(-c2cc(Cl)ccc2Cl)o1)c1nc2ccc(Cl)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C21H10Cl3N3O2/c22-12-1-4-17(24)15(8-12)19-6-3-14(29-19)7-11(10-25)20-26-18-5-2-13(23)9-16(18)21(28)27-20/h1-9H,(H,26,27,28)/b11-7+ |
| InChIKey | IJEBJSZTZJOHGJ-YRNVUSSQSA-N |
| XLogP | 6.21 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.69 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|