C21H11ClN3O3- — CID 7274580
2-[5-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]furan-2-yl]-4-chlorobenzoate (PubChem CID 7274580) has the molecular formula C21H11ClN3O3- and a molecular weight of 388.79 g/mol. Its IUPAC name is 2-[5-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]furan-2-yl]-4-chlorobenzoate.
| Compound Name | 2-[5-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]furan-2-yl]-4-chlorobenzoate |
|---|---|
| PubChem CID | 7274580 |
| Molecular Formula | C21H11ClN3O3- |
| Molecular Weight | 388.79 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 2-[5-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]furan-2-yl]-4-chlorobenzoate |
| SMILES | N#C/C(=C\c1ccc(-c2cc(Cl)ccc2C(=O)[O-])o1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H12ClN3O3/c22-13-5-7-15(21(26)27)16(10-13)19-8-6-14(28-19)9-12(11-23)20-24-17-3-1-2-4-18(17)25-20/h1-10H,(H,24,25)(H,26,27)/p-1/b12-9+ |
| InChIKey | MSJLKHFYVSOROP-FMIVXFBMSA-M |
| XLogP | 3.90 |
| TPSA | 105.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.79 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|