C21H14Cl2N4O3 — CID 90486045
(E)-2-(1H-benzimidazol-2-yl)-3-[5-(5-chloro-4-methyl-2-nitrophenyl)furan-2-yl]prop-2-enenitrile;hydrochloride (PubChem CID 90486045) has the molecular formula C21H14Cl2N4O3 and a molecular weight of 441.27 g/mol. Its IUPAC name is (E)-2-(1H-benzimidazol-2-yl)-3-[5-(5-chloro-4-methyl-2-nitrophenyl)furan-2-yl]prop-2-enenitrile;hydrochloride.
| Compound Name | (E)-2-(1H-benzimidazol-2-yl)-3-[5-(5-chloro-4-methyl-2-nitrophenyl)furan-2-yl]prop-2-enenitrile;hydrochloride |
|---|---|
| PubChem CID | 90486045 |
| Molecular Formula | C21H14Cl2N4O3 |
| Molecular Weight | 441.27 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | (E)-2-(1H-benzimidazol-2-yl)-3-[5-(5-chloro-4-methyl-2-nitrophenyl)furan-2-yl]prop-2-enenitrile;hydrochloride |
| SMILES | Cc1cc([N+](=O)[O-])c(-c2ccc(/C=C(\C#N)c3nc4ccccc4[nH]3)o2)cc1Cl.Cl |
| InChI | InChI=1S/C21H13ClN4O3.ClH/c1-12-8-19(26(27)28)15(10-16(12)22)20-7-6-14(29-20)9-13(11-23)21-24-17-4-2-3-5-18(17)25-21;/h2-10H,1H3,(H,24,25);1H/b13-9+; |
| InChIKey | DEPGCHZGOCMUIM-KJEVSKRMSA-N |
| XLogP | 6.18 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.27 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|