C20H11ClFN3O — CID 6063596
(E)-2-(1H-benzimidazol-2-yl)-3-[5-(3-chloro-4-fluorophenyl)furan-2-yl]prop-2-enenitrile (PubChem CID 6063596) has the molecular formula C20H11ClFN3O and a molecular weight of 363.78 g/mol. Its IUPAC name is (E)-2-(1H-benzimidazol-2-yl)-3-[5-(3-chloro-4-fluorophenyl)furan-2-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(1H-benzimidazol-2-yl)-3-[5-(3-chloro-4-fluorophenyl)furan-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 6063596 |
| Molecular Formula | C20H11ClFN3O |
| Molecular Weight | 363.78 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | (E)-2-(1H-benzimidazol-2-yl)-3-[5-(3-chloro-4-fluorophenyl)furan-2-yl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(-c2ccc(F)c(Cl)c2)o1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H11ClFN3O/c21-15-10-12(5-7-16(15)22)19-8-6-14(26-19)9-13(11-23)20-24-17-3-1-2-4-18(17)25-20/h1-10H,(H,24,25)/b13-9+ |
| InChIKey | DBTSWJFRQKEBIZ-UKTHLTGXSA-N |
| XLogP | 5.68 |
| TPSA | 65.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.78 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|