C24H15N3O3 — CID 50886930
prop-2-ynyl 3-[5-[(Z)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]furan-2-yl]benzoate (PubChem CID 50886930) has the molecular formula C24H15N3O3 and a molecular weight of 393.40 g/mol. Its IUPAC name is prop-2-ynyl 3-[5-[(Z)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]furan-2-yl]benzoate.
| Compound Name | prop-2-ynyl 3-[5-[(Z)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 50886930 |
| Molecular Formula | C24H15N3O3 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | prop-2-ynyl 3-[5-[(Z)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]furan-2-yl]benzoate |
| SMILES | C#CCOC(=O)c1cccc(-c2ccc(/C=C(/C#N)c3nc4ccccc4[nH]3)o2)c1 |
| InChI | InChI=1S/C24H15N3O3/c1-2-12-29-24(28)17-7-5-6-16(13-17)22-11-10-19(30-22)14-18(15-25)23-26-20-8-3-4-9-21(20)27-23/h1,3-11,13-14H,12H2,(H,26,27)/b18-14- |
| InChIKey | RWRDCYUIFZNAML-JXAWBTAJSA-N |
| XLogP | 4.68 |
| TPSA | 91.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|