C20H11BrN4O3 — CID 2922185
3-[5-[2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-2-cyanoethenyl]furan-2-yl]benzoic acid (PubChem CID 2922185) has the molecular formula C20H11BrN4O3 and a molecular weight of 435.24 g/mol. Its IUPAC name is 3-[5-[2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-2-cyanoethenyl]furan-2-yl]benzoic acid.
| Compound Name | 3-[5-[2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-2-cyanoethenyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 2922185 |
| Molecular Formula | C20H11BrN4O3 |
| Molecular Weight | 435.24 g/mol |
| Exact Mass | 434.00 |
| IUPAC Name | 3-[5-[2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-2-cyanoethenyl]furan-2-yl]benzoic acid |
| SMILES | N#CC(=Cc1ccc(-c2cccc(C(=O)O)c2)o1)c1nc2ncc(Br)cc2[nH]1 |
| InChI | InChI=1S/C20H11BrN4O3/c21-14-8-16-19(23-10-14)25-18(24-16)13(9-22)7-15-4-5-17(28-15)11-2-1-3-12(6-11)20(26)27/h1-8,10H,(H,26,27)(H,23,24,25) |
| InChIKey | LXMWWSMGNHKVET-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 115.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.24 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|