C24H19N3O3 — CID 4518362
3-[5-[2-cyano-2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethenyl]furan-2-yl]-4-methylbenzoic acid (PubChem CID 4518362) has the molecular formula C24H19N3O3 and a molecular weight of 397.43 g/mol. Its IUPAC name is 3-[5-[2-cyano-2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethenyl]furan-2-yl]-4-methylbenzoic acid.
| Compound Name | 3-[5-[2-cyano-2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethenyl]furan-2-yl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 4518362 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 3-[5-[2-cyano-2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethenyl]furan-2-yl]-4-methylbenzoic acid |
| SMILES | Cc1cc2nc(C(C#N)=Cc3ccc(-c4cc(C(=O)O)ccc4C)o3)[nH]c2cc1C |
| InChI | InChI=1S/C24H19N3O3/c1-13-4-5-16(24(28)29)11-19(13)22-7-6-18(30-22)10-17(12-25)23-26-20-8-14(2)15(3)9-21(20)27-23/h4-11H,1-3H3,(H,26,27)(H,28,29) |
| InChIKey | VMTOQJQQDSAFNC-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|