C22H14ClN3O3 — CID 3968759
4-chloro-3-[5-[2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]furan-2-yl]benzoic acid (PubChem CID 3968759) has the molecular formula C22H14ClN3O3 and a molecular weight of 403.83 g/mol. Its IUPAC name is 4-chloro-3-[5-[2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]furan-2-yl]benzoic acid.
| Compound Name | 4-chloro-3-[5-[2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 3968759 |
| Molecular Formula | C22H14ClN3O3 |
| Molecular Weight | 403.83 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 4-chloro-3-[5-[2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]furan-2-yl]benzoic acid |
| SMILES | Cc1ccc2nc(C(C#N)=Cc3ccc(-c4cc(C(=O)O)ccc4Cl)o3)[nH]c2c1 |
| InChI | InChI=1S/C22H14ClN3O3/c1-12-2-6-18-19(8-12)26-21(25-18)14(11-24)9-15-4-7-20(29-15)16-10-13(22(27)28)3-5-17(16)23/h2-10H,1H3,(H,25,26)(H,27,28) |
| InChIKey | SSUVHHIHMWMNND-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.83 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|