C29H17N3O3 — CID 50884479
(Z)-3-[5-(9,10-dioxoanthracen-2-yl)furan-2-yl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile (PubChem CID 50884479) has the molecular formula C29H17N3O3 and a molecular weight of 455.47 g/mol. Its IUPAC name is (Z)-3-[5-(9,10-dioxoanthracen-2-yl)furan-2-yl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-[5-(9,10-dioxoanthracen-2-yl)furan-2-yl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 50884479 |
| Molecular Formula | C29H17N3O3 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | (Z)-3-[5-(9,10-dioxoanthracen-2-yl)furan-2-yl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1ccc2nc(/C(C#N)=C\c3ccc(-c4ccc5c(c4)C(=O)c4ccccc4C5=O)o3)[nH]c2c1 |
| InChI | InChI=1S/C29H17N3O3/c1-16-6-10-24-25(12-16)32-29(31-24)18(15-30)13-19-8-11-26(35-19)17-7-9-22-23(14-17)28(34)21-5-3-2-4-20(21)27(22)33/h2-14H,1H3,(H,31,32)/b18-13- |
| InChIKey | UWPJRXVOHQEQEP-AQTBWJFISA-N |
| XLogP | 5.97 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|