C22H13N3O3 — CID 71453384
(E)-2-(1H-benzimidazol-2-yl)-3-[5-(3-oxo-1H-2-benzofuran-5-yl)furan-2-yl]prop-2-enenitrile (PubChem CID 71453384) has the molecular formula C22H13N3O3 and a molecular weight of 367.36 g/mol. Its IUPAC name is (E)-2-(1H-benzimidazol-2-yl)-3-[5-(3-oxo-1H-2-benzofuran-5-yl)furan-2-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(1H-benzimidazol-2-yl)-3-[5-(3-oxo-1H-2-benzofuran-5-yl)furan-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 71453384 |
| Molecular Formula | C22H13N3O3 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | (E)-2-(1H-benzimidazol-2-yl)-3-[5-(3-oxo-1H-2-benzofuran-5-yl)furan-2-yl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(-c2ccc3c(c2)C(=O)OC3)o1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H13N3O3/c23-11-15(21-24-18-3-1-2-4-19(18)25-21)9-16-7-8-20(28-16)13-5-6-14-12-27-22(26)17(14)10-13/h1-10H,12H2,(H,24,25)/b15-9+ |
| InChIKey | HQNBEKANKBTGRQ-OQLLNIDSSA-N |
| XLogP | 4.56 |
| TPSA | 91.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|