C20H11Cl2N3O — CID 2850991
2-(1H-benzimidazol-2-yl)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enenitrile (PubChem CID 2850991) has the molecular formula C20H11Cl2N3O and a molecular weight of 380.23 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 2850991 |
| Molecular Formula | C20H11Cl2N3O |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(-c2cccc(Cl)c2Cl)o1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H11Cl2N3O/c21-15-5-3-4-14(19(15)22)18-9-8-13(26-18)10-12(11-23)20-24-16-6-1-2-7-17(16)25-20/h1-10H,(H,24,25) |
| InChIKey | APFPNZUYGYATPB-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 65.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|