C19H11Cl2NO — CID 726351
(Z)-3-[5-(2,3-dichlorophenyl)furan-2-yl]-2-phenylprop-2-enenitrile (PubChem CID 726351) has the molecular formula C19H11Cl2NO and a molecular weight of 340.21 g/mol. Its IUPAC name is (Z)-3-[5-(2,3-dichlorophenyl)furan-2-yl]-2-phenylprop-2-enenitrile.
| Compound Name | (Z)-3-[5-(2,3-dichlorophenyl)furan-2-yl]-2-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 726351 |
| Molecular Formula | C19H11Cl2NO |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | (Z)-3-[5-(2,3-dichlorophenyl)furan-2-yl]-2-phenylprop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(-c2cccc(Cl)c2Cl)o1)c1ccccc1 |
| InChI | InChI=1S/C19H11Cl2NO/c20-17-8-4-7-16(19(17)21)18-10-9-15(23-18)11-14(12-22)13-5-2-1-3-6-13/h1-11H/b14-11+ |
| InChIKey | OXJUNMCQCLHMFL-SDNWHVSQSA-N |
| XLogP | 6.32 |
| TPSA | 36.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|