C26H15Cl2NO2S — CID 3903152
2-(1,3-benzothiazol-2-yl)-3-[5-(2,3-dichlorophenyl)furan-2-yl]-1-phenylprop-2-en-1-one (PubChem CID 3903152) has the molecular formula C26H15Cl2NO2S and a molecular weight of 476.38 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-3-[5-(2,3-dichlorophenyl)furan-2-yl]-1-phenylprop-2-en-1-one.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-3-[5-(2,3-dichlorophenyl)furan-2-yl]-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 3903152 |
| Molecular Formula | C26H15Cl2NO2S |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 475.02 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-3-[5-(2,3-dichlorophenyl)furan-2-yl]-1-phenylprop-2-en-1-one |
| SMILES | O=C(C(=Cc1ccc(-c2cccc(Cl)c2Cl)o1)c1nc2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C26H15Cl2NO2S/c27-20-10-6-9-18(24(20)28)22-14-13-17(31-22)15-19(25(30)16-7-2-1-3-8-16)26-29-21-11-4-5-12-23(21)32-26/h1-15H |
| InChIKey | HXFHBILCSCGNKF-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|