C24H19NOS — CID 7948078
(Z)-2-(1,3-benzothiazol-2-yl)-3-(4-ethylphenyl)-1-phenylprop-2-en-1-one (PubChem CID 7948078) has the molecular formula C24H19NOS and a molecular weight of 369.49 g/mol. Its IUPAC name is (Z)-2-(1,3-benzothiazol-2-yl)-3-(4-ethylphenyl)-1-phenylprop-2-en-1-one.
| Compound Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-(4-ethylphenyl)-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 7948078 |
| Molecular Formula | C24H19NOS |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-(4-ethylphenyl)-1-phenylprop-2-en-1-one |
| SMILES | CCc1ccc(/C=C(/C(=O)c2ccccc2)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C24H19NOS/c1-2-17-12-14-18(15-13-17)16-20(23(26)19-8-4-3-5-9-19)24-25-21-10-6-7-11-22(21)27-24/h3-16H,2H2,1H3/b20-16- |
| InChIKey | ACQYWZYRRJJCRG-SILNSSARSA-N |
| XLogP | 6.28 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|