C25H21NO3S — CID 7948071
(Z)-2-(1,3-benzothiazol-2-yl)-3-(4-ethoxy-3-methoxyphenyl)-1-phenylprop-2-en-1-one (PubChem CID 7948071) has the molecular formula C25H21NO3S and a molecular weight of 415.51 g/mol. Its IUPAC name is (Z)-2-(1,3-benzothiazol-2-yl)-3-(4-ethoxy-3-methoxyphenyl)-1-phenylprop-2-en-1-one.
| Compound Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-(4-ethoxy-3-methoxyphenyl)-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 7948071 |
| Molecular Formula | C25H21NO3S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-(4-ethoxy-3-methoxyphenyl)-1-phenylprop-2-en-1-one |
| SMILES | CCOc1ccc(/C=C(/C(=O)c2ccccc2)c2nc3ccccc3s2)cc1OC |
| InChI | InChI=1S/C25H21NO3S/c1-3-29-21-14-13-17(16-22(21)28-2)15-19(24(27)18-9-5-4-6-10-18)25-26-20-11-7-8-12-23(20)30-25/h4-16H,3H2,1-2H3/b19-15- |
| InChIKey | OPLOEJNSGOZQFF-CYVLTUHYSA-N |
| XLogP | 6.13 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|