C19H16N2O2S — CID 3469156
2-(1,3-benzothiazol-2-yl)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enenitrile (PubChem CID 3469156) has the molecular formula C19H16N2O2S and a molecular weight of 336.42 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enenitrile.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3469156 |
| Molecular Formula | C19H16N2O2S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enenitrile |
| SMILES | CCOc1cc(C=C(C#N)c2nc3ccccc3s2)ccc1OC |
| InChI | InChI=1S/C19H16N2O2S/c1-3-23-17-11-13(8-9-16(17)22-2)10-14(12-20)19-21-15-6-4-5-7-18(15)24-19/h4-11H,3H2,1-2H3 |
| InChIKey | CDUHYRWAYDGCPH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|