C26H22N2O2S — CID 20998227
2-(1,3-benzothiazol-2-yl)-3-[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]prop-2-enenitrile (PubChem CID 20998227) has the molecular formula C26H22N2O2S and a molecular weight of 426.54 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-3-[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]prop-2-enenitrile.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-3-[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 20998227 |
| Molecular Formula | C26H22N2O2S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-3-[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]prop-2-enenitrile |
| SMILES | CCOc1cc(C=C(C#N)c2nc3ccccc3s2)ccc1OCc1cccc(C)c1 |
| InChI | InChI=1S/C26H22N2O2S/c1-3-29-24-15-19(11-12-23(24)30-17-20-8-6-7-18(2)13-20)14-21(16-27)26-28-22-9-4-5-10-25(22)31-26/h4-15H,3,17H2,1-2H3 |
| InChIKey | XUAXIHWVENRFSU-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|