C25H17F3N2O2S — CID 4679244
2-(1,3-benzothiazol-2-yl)-3-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enenitrile (PubChem CID 4679244) has the molecular formula C25H17F3N2O2S and a molecular weight of 466.48 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-3-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enenitrile.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-3-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 4679244 |
| Molecular Formula | C25H17F3N2O2S |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-3-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enenitrile |
| SMILES | COc1cc(C=C(C#N)c2nc3ccccc3s2)ccc1OCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H17F3N2O2S/c1-31-22-13-16(11-18(14-29)24-30-20-7-2-3-8-23(20)33-24)9-10-21(22)32-15-17-5-4-6-19(12-17)25(26,27)28/h2-13H,15H2,1H3 |
| InChIKey | MQRKVWOAOBXXAG-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|